C22H23NO4 — CID 3051269
[2-(dimethylamino)-1-phenylethyl] 5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate (PubChem CID 3051269) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is [2-(dimethylamino)-1-phenylethyl] 5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate.
| Compound Name | [2-(dimethylamino)-1-phenylethyl] 5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 3051269 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | [2-(dimethylamino)-1-phenylethyl] 5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate |
| SMILES | CN(C)CC(OC(=O)C=CC=Cc1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C22H23NO4/c1-23(2)15-21(18-9-4-3-5-10-18)27-22(24)11-7-6-8-17-12-13-19-20(14-17)26-16-25-19/h3-14,21H,15-16H2,1-2H3 |
| InChIKey | RNOAWLFRSHTLIJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|