C18H20O6 — CID 88924123
2,2-dimethylpropanoyloxymethyl (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate (PubChem CID 88924123) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 88924123 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)/C=C/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H20O6/c1-18(2,3)17(20)24-12-23-16(19)7-5-4-6-13-8-9-14-15(10-13)22-11-21-14/h4-10H,11-12H2,1-3H3/b6-4+,7-5+ |
| InChIKey | PMYARPSCUGFGCC-YDFGWWAZSA-N |
| XLogP | 3.07 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|