C28H34O7 — CID 157257701
1,3-benzodioxole-5-carbaldehyde;(E)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-one;3,3-dimethylbutan-2-one (PubChem CID 157257701) has the molecular formula C28H34O7 and a molecular weight of 482.57 g/mol. Its IUPAC name is 1,3-benzodioxole-5-carbaldehyde;(E)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-one;3,3-dimethylbutan-2-one.
| Compound Name | 1,3-benzodioxole-5-carbaldehyde;(E)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-one;3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 157257701 |
| Molecular Formula | C28H34O7 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 1,3-benzodioxole-5-carbaldehyde;(E)-1-(1,3-benzodioxol-5-yl)-4,4-dimethylpent-1-en-3-one;3,3-dimethylbutan-2-one |
| SMILES | CC(=O)C(C)(C)C.CC(C)(C)C(=O)/C=C/c1ccc2c(c1)OCO2.O=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H16O3.C8H6O3.C6H12O/c1-14(2,3)13(15)7-5-10-4-6-11-12(8-10)17-9-16-11;9-4-6-1-2-7-8(3-6)11-5-10-7;1-5(7)6(2,3)4/h4-8H,9H2,1-3H3;1-4H,5H2;1-4H3/b7-5+;; |
| InChIKey | AXBVQESAXXFYBX-WVKUUHRJSA-N |
| XLogP | 5.89 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|