C13H16O3 — CID 143300593
(E)-3-(1,3-benzodioxol-5-yl)-2-methylprop-2-enal;ethane (PubChem CID 143300593) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-2-methylprop-2-enal;ethane.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-2-methylprop-2-enal;ethane |
|---|---|
| PubChem CID | 143300593 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-2-methylprop-2-enal;ethane |
| SMILES | C/C(C=O)=C\c1ccc2c(c1)OCO2.CC |
| InChI | InChI=1S/C11H10O3.C2H6/c1-8(6-12)4-9-2-3-10-11(5-9)14-7-13-10;1-2/h2-6H,7H2,1H3;1-2H3/b8-4+; |
| InChIKey | WPRLDXLHJLMGRL-ZFXMFRGYSA-N |
| XLogP | 3.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|