C11H12O3 — CID 143128827
(Z)-3-(1,3-benzodioxol-5-yl)-2-methylprop-2-en-1-ol (PubChem CID 143128827) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is (Z)-3-(1,3-benzodioxol-5-yl)-2-methylprop-2-en-1-ol.
| Compound Name | (Z)-3-(1,3-benzodioxol-5-yl)-2-methylprop-2-en-1-ol |
|---|---|
| PubChem CID | 143128827 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | (Z)-3-(1,3-benzodioxol-5-yl)-2-methylprop-2-en-1-ol |
| SMILES | C/C(=C/c1ccc2c(c1)OCO2)CO |
| InChI | InChI=1S/C11H12O3/c1-8(6-12)4-9-2-3-10-11(5-9)14-7-13-10/h2-5,12H,6-7H2,1H3/b8-4- |
| InChIKey | XGABMOOENRNOTG-YWEYNIOJSA-N |
| XLogP | 1.81 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |