C14H15NO3 — CID 3065846
5-(1,3-benzodioxol-5-yl)-N,N-dimethylpenta-2,4-dienamide (PubChem CID 3065846) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-N,N-dimethylpenta-2,4-dienamide.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-N,N-dimethylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 3065846 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-N,N-dimethylpenta-2,4-dienamide |
| SMILES | CN(C)C(=O)C=CC=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H15NO3/c1-15(2)14(16)6-4-3-5-11-7-8-12-13(9-11)18-10-17-12/h3-9H,10H2,1-2H3 |
| InChIKey | HIAJIHWXNBJYOF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|