C16H17Cl2NO3 — CID 88784314
(2E)-5-(1,3-benzodioxol-5-yl)-N,N-bis(2-chloroethyl)penta-2,4-dienamide (PubChem CID 88784314) has the molecular formula C16H17Cl2NO3 and a molecular weight of 342.22 g/mol. Its IUPAC name is (2E)-5-(1,3-benzodioxol-5-yl)-N,N-bis(2-chloroethyl)penta-2,4-dienamide.
| Compound Name | (2E)-5-(1,3-benzodioxol-5-yl)-N,N-bis(2-chloroethyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 88784314 |
| Molecular Formula | C16H17Cl2NO3 |
| Molecular Weight | 342.22 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | (2E)-5-(1,3-benzodioxol-5-yl)-N,N-bis(2-chloroethyl)penta-2,4-dienamide |
| SMILES | O=C(/C=C/C=Cc1ccc2c(c1)OCO2)N(CCCl)CCCl |
| InChI | InChI=1S/C16H17Cl2NO3/c17-7-9-19(10-8-18)16(20)4-2-1-3-13-5-6-14-15(11-13)22-12-21-14/h1-6,11H,7-10,12H2/b3-1?,4-2+ |
| InChIKey | TUQOTTJXSCNWQG-RWOTWAKKSA-N |
| XLogP | 3.29 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.22 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|