C16H17ClO4 — CID 118579967
(2-chloro-2-methylpropyl) (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate (PubChem CID 118579967) has the molecular formula C16H17ClO4 and a molecular weight of 308.76 g/mol. Its IUPAC name is (2-chloro-2-methylpropyl) (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate.
| Compound Name | (2-chloro-2-methylpropyl) (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 118579967 |
| Molecular Formula | C16H17ClO4 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (2-chloro-2-methylpropyl) (2E,4E)-5-(1,3-benzodioxol-5-yl)penta-2,4-dienoate |
| SMILES | CC(C)(Cl)COC(=O)/C=C/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H17ClO4/c1-16(2,17)10-19-15(18)6-4-3-5-12-7-8-13-14(9-12)21-11-20-13/h3-9H,10-11H2,1-2H3/b5-3+,6-4+ |
| InChIKey | CGCJDXFHZRPIAG-GGWOSOGESA-N |
| XLogP | 3.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|