C24H26N2O5 — CID 4786510
[1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 4786510) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 4786510 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | CC(OC(=O)C=Cc1ccc2c(c1)OCO2)C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H26N2O5/c1-18(31-23(27)10-8-19-7-9-21-22(15-19)30-17-29-21)24(28)26-13-11-25(12-14-26)16-20-5-3-2-4-6-20/h2-10,15,18H,11-14,16-17H2,1H3 |
| InChIKey | ZRKQGHNUUPVSPB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|