C25H29N3O4 — CID 55355029
[1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 2-acetamido-3-phenylprop-2-enoate (PubChem CID 55355029) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 2-acetamido-3-phenylprop-2-enoate.
| Compound Name | [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 2-acetamido-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 55355029 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 2-acetamido-3-phenylprop-2-enoate |
| SMILES | CC(=O)NC(=Cc1ccccc1)C(=O)OC(C)C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H29N3O4/c1-19(32-25(31)23(26-20(2)29)17-21-9-5-3-6-10-21)24(30)28-15-13-27(14-16-28)18-22-11-7-4-8-12-22/h3-12,17,19H,13-16,18H2,1-2H3,(H,26,29) |
| InChIKey | APSTXTMDLNCWRA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|