C28H30N2O3 — CID 4833570
[1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 2,2-diphenylacetate (PubChem CID 4833570) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 2,2-diphenylacetate.
| Compound Name | [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 2,2-diphenylacetate |
|---|---|
| PubChem CID | 4833570 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 2,2-diphenylacetate |
| SMILES | CC(OC(=O)C(c1ccccc1)c1ccccc1)C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H30N2O3/c1-22(27(31)30-19-17-29(18-20-30)21-23-11-5-2-6-12-23)33-28(32)26(24-13-7-3-8-14-24)25-15-9-4-10-16-25/h2-16,22,26H,17-21H2,1H3 |
| InChIKey | FCZVIXVQAWWCEB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |