C24H28N2O4 — CID 55355067
[1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-oxo-4-phenylbutanoate (PubChem CID 55355067) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-oxo-4-phenylbutanoate.
| Compound Name | [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-oxo-4-phenylbutanoate |
|---|---|
| PubChem CID | 55355067 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-oxo-4-phenylbutanoate |
| SMILES | CC(OC(=O)CCC(=O)c1ccccc1)C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H28N2O4/c1-19(30-23(28)13-12-22(27)21-10-6-3-7-11-21)24(29)26-16-14-25(15-17-26)18-20-8-4-2-5-9-20/h2-11,19H,12-18H2,1H3 |
| InChIKey | TZDPHJAJOHQNNM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |