C24H31N3O5S — CID 55475903
[1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 3-[4-(methylsulfamoyl)phenyl]propanoate (PubChem CID 55475903) has the molecular formula C24H31N3O5S and a molecular weight of 473.60 g/mol. Its IUPAC name is [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 3-[4-(methylsulfamoyl)phenyl]propanoate.
| Compound Name | [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 3-[4-(methylsulfamoyl)phenyl]propanoate |
|---|---|
| PubChem CID | 55475903 |
| Molecular Formula | C24H31N3O5S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 3-[4-(methylsulfamoyl)phenyl]propanoate |
| SMILES | CNS(=O)(=O)c1ccc(CCC(=O)OC(C)C(=O)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H31N3O5S/c1-19(24(29)27-16-14-26(15-17-27)18-21-6-4-3-5-7-21)32-23(28)13-10-20-8-11-22(12-9-20)33(30,31)25-2/h3-9,11-12,19,25H,10,13-18H2,1-2H3 |
| InChIKey | YICXIMHIJCCCLX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |