C27H27NO3 — CID 145067040
formamide;[(E)-1-(4-methylphenyl)-4-phenylbut-3-enyl] (E)-3-phenylprop-2-enoate (PubChem CID 145067040) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is formamide;[(E)-1-(4-methylphenyl)-4-phenylbut-3-enyl] (E)-3-phenylprop-2-enoate.
| Compound Name | formamide;[(E)-1-(4-methylphenyl)-4-phenylbut-3-enyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 145067040 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | formamide;[(E)-1-(4-methylphenyl)-4-phenylbut-3-enyl] (E)-3-phenylprop-2-enoate |
| SMILES | Cc1ccc(C(C/C=C/c2ccccc2)OC(=O)/C=C/c2ccccc2)cc1.NC=O |
| InChI | InChI=1S/C26H24O2.CH3NO/c1-21-15-18-24(19-16-21)25(14-8-13-22-9-4-2-5-10-22)28-26(27)20-17-23-11-6-3-7-12-23;2-1-3/h2-13,15-20,25H,14H2,1H3;1H,(H2,2,3)/b13-8+,20-17+; |
| InChIKey | OXNJAWMPYDTUNM-NAGVFMBTSA-N |
| XLogP | 5.50 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|