C24H23NO5 — CID 138523236
[(1R)-2-benzamido-1-(3,4-dimethoxyphenyl)ethyl] benzoate (PubChem CID 138523236) has the molecular formula C24H23NO5 and a molecular weight of 405.45 g/mol. Its IUPAC name is [(1R)-2-benzamido-1-(3,4-dimethoxyphenyl)ethyl] benzoate.
| Compound Name | [(1R)-2-benzamido-1-(3,4-dimethoxyphenyl)ethyl] benzoate |
|---|---|
| PubChem CID | 138523236 |
| Molecular Formula | C24H23NO5 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [(1R)-2-benzamido-1-(3,4-dimethoxyphenyl)ethyl] benzoate |
| SMILES | COc1ccc([C@H](CNC(=O)c2ccccc2)OC(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C24H23NO5/c1-28-20-14-13-19(15-21(20)29-2)22(30-24(27)18-11-7-4-8-12-18)16-25-23(26)17-9-5-3-6-10-17/h3-15,22H,16H2,1-2H3,(H,25,26)/t22-/m0/s1 |
| InChIKey | DSZFMCMMQQTQQC-QFIPXVFZSA-N |
| XLogP | 4.03 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |