C28H31NO5 — CID 138523213
[(1R)-1-(3,4-dimethoxyphenyl)-2-(3-phenylpropanoylamino)ethyl] 3-phenylpropanoate (PubChem CID 138523213) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is [(1R)-1-(3,4-dimethoxyphenyl)-2-(3-phenylpropanoylamino)ethyl] 3-phenylpropanoate.
| Compound Name | [(1R)-1-(3,4-dimethoxyphenyl)-2-(3-phenylpropanoylamino)ethyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 138523213 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | [(1R)-1-(3,4-dimethoxyphenyl)-2-(3-phenylpropanoylamino)ethyl] 3-phenylpropanoate |
| SMILES | COc1ccc([C@H](CNC(=O)CCc2ccccc2)OC(=O)CCc2ccccc2)cc1OC |
| InChI | InChI=1S/C28H31NO5/c1-32-24-16-15-23(19-25(24)33-2)26(34-28(31)18-14-22-11-7-4-8-12-22)20-29-27(30)17-13-21-9-5-3-6-10-21/h3-12,15-16,19,26H,13-14,17-18,20H2,1-2H3,(H,29,30)/t26-/m0/s1 |
| InChIKey | JPHFQIBCRFUQJL-SANMLTNESA-N |
| XLogP | 4.67 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |