C19H23NO4 — CID 138534631
[(1S)-2-amino-1-(3,4-dimethoxyphenyl)ethyl] 3-phenylpropanoate (PubChem CID 138534631) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is [(1S)-2-amino-1-(3,4-dimethoxyphenyl)ethyl] 3-phenylpropanoate.
| Compound Name | [(1S)-2-amino-1-(3,4-dimethoxyphenyl)ethyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 138534631 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | [(1S)-2-amino-1-(3,4-dimethoxyphenyl)ethyl] 3-phenylpropanoate |
| SMILES | COc1ccc([C@@H](CN)OC(=O)CCc2ccccc2)cc1OC |
| InChI | InChI=1S/C19H23NO4/c1-22-16-10-9-15(12-17(16)23-2)18(13-20)24-19(21)11-8-14-6-4-3-5-7-14/h3-7,9-10,12,18H,8,11,13,20H2,1-2H3/t18-/m1/s1 |
| InChIKey | MERYCIWLBDDBGB-GOSISDBHSA-N |
| XLogP | 2.88 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |