C24H24O5 — CID 71357609
2,2-bis(3,4-dimethoxyphenyl)-1-phenylethanone (PubChem CID 71357609) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is 2,2-bis(3,4-dimethoxyphenyl)-1-phenylethanone.
| Compound Name | 2,2-bis(3,4-dimethoxyphenyl)-1-phenylethanone |
|---|---|
| PubChem CID | 71357609 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2,2-bis(3,4-dimethoxyphenyl)-1-phenylethanone |
| SMILES | COc1ccc(C(C(=O)c2ccccc2)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C24H24O5/c1-26-19-12-10-17(14-21(19)28-3)23(24(25)16-8-6-5-7-9-16)18-11-13-20(27-2)22(15-18)29-4/h5-15,23H,1-4H3 |
| InChIKey | OZJGSKXLJMKYHK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |