C26H28O7 — CID 102130083
1-phenyl-2,2-bis(2,4,5-trimethoxyphenyl)ethanone (PubChem CID 102130083) has the molecular formula C26H28O7 and a molecular weight of 452.50 g/mol. Its IUPAC name is 1-phenyl-2,2-bis(2,4,5-trimethoxyphenyl)ethanone.
| Compound Name | 1-phenyl-2,2-bis(2,4,5-trimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 102130083 |
| Molecular Formula | C26H28O7 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 1-phenyl-2,2-bis(2,4,5-trimethoxyphenyl)ethanone |
| SMILES | COc1cc(OC)c(C(C(=O)c2ccccc2)c2cc(OC)c(OC)cc2OC)cc1OC |
| InChI | InChI=1S/C26H28O7/c1-28-19-14-23(32-5)21(30-3)12-17(19)25(26(27)16-10-8-7-9-11-16)18-13-22(31-4)24(33-6)15-20(18)29-2/h7-15,25H,1-6H3 |
| InChIKey | NFDOKRLQYUKSQW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |