C22H20O4 — CID 10360372
2-[2-[hydroperoxy(methoxy)methyl]phenyl]-1,2-diphenylethanone (PubChem CID 10360372) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[2-[hydroperoxy(methoxy)methyl]phenyl]-1,2-diphenylethanone.
| Compound Name | 2-[2-[hydroperoxy(methoxy)methyl]phenyl]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 10360372 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-[2-[hydroperoxy(methoxy)methyl]phenyl]-1,2-diphenylethanone |
| SMILES | COC(OO)c1ccccc1C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20O4/c1-25-22(26-24)19-15-9-8-14-18(19)20(16-10-4-2-5-11-16)21(23)17-12-6-3-7-13-17/h2-15,20,22,24H,1H3 |
| InChIKey | DRVUUQIDFOSMNR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|