C23H22O3 — CID 159117865
2-methoxy-1,2-diphenylethanone;1-phenylethanone (PubChem CID 159117865) has the molecular formula C23H22O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-methoxy-1,2-diphenylethanone;1-phenylethanone.
| Compound Name | 2-methoxy-1,2-diphenylethanone;1-phenylethanone |
|---|---|
| PubChem CID | 159117865 |
| Molecular Formula | C23H22O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-methoxy-1,2-diphenylethanone;1-phenylethanone |
| SMILES | CC(=O)c1ccccc1.COC(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14O2.C8H8O/c1-17-15(13-10-6-3-7-11-13)14(16)12-8-4-2-5-9-12;1-7(9)8-5-3-2-4-6-8/h2-11,15H,1H3;2-6H,1H3 |
| InChIKey | KFHRCJPRMXTGAF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |