C56H46O7 — CID 19854989
bis(2-(2-oxo-1,2-diphenylethoxy)-1,2-diphenylethanone);hydrate (PubChem CID 19854989) has the molecular formula C56H46O7 and a molecular weight of 830.98 g/mol. Its IUPAC name is bis(2-(2-oxo-1,2-diphenylethoxy)-1,2-diphenylethanone);hydrate.
| Compound Name | bis(2-(2-oxo-1,2-diphenylethoxy)-1,2-diphenylethanone);hydrate |
|---|---|
| PubChem CID | 19854989 |
| Molecular Formula | C56H46O7 |
| Molecular Weight | 830.98 g/mol |
| Exact Mass | 830.32 |
| IUPAC Name | bis(2-(2-oxo-1,2-diphenylethoxy)-1,2-diphenylethanone);hydrate |
| SMILES | O.O=C(c1ccccc1)C(OC(C(=O)c1ccccc1)c1ccccc1)c1ccccc1.O=C(c1ccccc1)C(OC(C(=O)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C28H22O3.H2O/c2*29-25(21-13-5-1-6-14-21)27(23-17-9-3-10-18-23)31-28(24-19-11-4-12-20-24)26(30)22-15-7-2-8-16-22;/h2*1-20,27-28H;1H2 |
| InChIKey | BBCWAIMONBSBLF-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 118.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.98 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |