C14H14O2 — CID 158356694
deuterium monohydride;2-hydroxy-1,2-diphenylethanone (PubChem CID 158356694) has the molecular formula C14H14O2 and a molecular weight of 215.27 g/mol. Its IUPAC name is deuterium monohydride;2-hydroxy-1,2-diphenylethanone.
| Compound Name | deuterium monohydride;2-hydroxy-1,2-diphenylethanone |
|---|---|
| PubChem CID | 158356694 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | deuterium monohydride;2-hydroxy-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)C(O)c1ccccc1.[H][2H] |
| InChI | InChI=1S/C14H12O2.H2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;/h1-10,13,15H;1H/i;1+1 |
| InChIKey | GSYSXXQZBNQMOX-IEOVAKBOSA-N |
| XLogP | 2.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |