C29H26O5 — CID 174440021
formaldehyde;bis(2-hydroxy-1,2-diphenylethanone) (PubChem CID 174440021) has the molecular formula C29H26O5 and a molecular weight of 454.52 g/mol. Its IUPAC name is formaldehyde;bis(2-hydroxy-1,2-diphenylethanone).
| Compound Name | formaldehyde;bis(2-hydroxy-1,2-diphenylethanone) |
|---|---|
| PubChem CID | 174440021 |
| Molecular Formula | C29H26O5 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | formaldehyde;bis(2-hydroxy-1,2-diphenylethanone) |
| SMILES | C=O.O=C(c1ccccc1)C(O)c1ccccc1.O=C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/2C14H12O2.CH2O/c2*15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-2/h2*1-10,13,15H;1H2 |
| InChIKey | LXAXJVBAIZWRLD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |