C42H36O6 — CID 159399559
2-hydroxy-1,2-diphenylethanone (PubChem CID 159399559) has the molecular formula C42H36O6 and a molecular weight of 636.74 g/mol. Its IUPAC name is 2-hydroxy-1,2-diphenylethanone.
| Compound Name | 2-hydroxy-1,2-diphenylethanone |
|---|---|
| PubChem CID | 159399559 |
| Molecular Formula | C42H36O6 |
| Molecular Weight | 636.74 g/mol |
| Exact Mass | 636.25 |
| IUPAC Name | 2-hydroxy-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)C(O)c1ccccc1.O=C(c1ccccc1)C(O)c1ccccc1.O=C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/3C14H12O2/c3*15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h3*1-10,13,15H |
| InChIKey | LNDXNFNZMKQXGI-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.74 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |