C23H30O3 — CID 69310835
2-hydroxy-1,2-diphenylethanone;nonan-5-one (PubChem CID 69310835) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-hydroxy-1,2-diphenylethanone;nonan-5-one.
| Compound Name | 2-hydroxy-1,2-diphenylethanone;nonan-5-one |
|---|---|
| PubChem CID | 69310835 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 2-hydroxy-1,2-diphenylethanone;nonan-5-one |
| SMILES | CCCCC(=O)CCCC.O=C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H12O2.C9H18O/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-3-5-7-9(10)8-6-4-2/h1-10,13,15H;3-8H2,1-2H3 |
| InChIKey | GUXAYAIFWCWAAD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |