C17H20O4 — CID 69429454
ethoxymethanol;2-hydroxy-1,2-diphenylethanone (PubChem CID 69429454) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is ethoxymethanol;2-hydroxy-1,2-diphenylethanone.
| Compound Name | ethoxymethanol;2-hydroxy-1,2-diphenylethanone |
|---|---|
| PubChem CID | 69429454 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | ethoxymethanol;2-hydroxy-1,2-diphenylethanone |
| SMILES | CCOCO.O=C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H12O2.C3H8O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-2-5-3-4/h1-10,13,15H;4H,2-3H2,1H3 |
| InChIKey | JKDCDHAUBLMXHW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|