C22H32O7P2S2 — CID 88633467
diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;2-hydroxy-1,2-diphenylethanone (PubChem CID 88633467) has the molecular formula C22H32O7P2S2 and a molecular weight of 534.57 g/mol. Its IUPAC name is diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;2-hydroxy-1,2-diphenylethanone.
| Compound Name | diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;2-hydroxy-1,2-diphenylethanone |
|---|---|
| PubChem CID | 88633467 |
| Molecular Formula | C22H32O7P2S2 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | diethoxyphosphinothioyloxy-diethoxy-sulfanylidene-λ5-phosphane;2-hydroxy-1,2-diphenylethanone |
| SMILES | CCOP(=S)(OCC)OP(=S)(OCC)OCC.O=C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H12O2.C8H20O5P2S2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-5-9-14(16,10-6-2)13-15(17,11-7-3)12-8-4/h1-10,13,15H;5-8H2,1-4H3 |
| InChIKey | YMDBCPJHTAEXQU-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|