C14H18O3Si2 — CID 173133276
2-hydroxy-1,2-diphenylethanone;silyloxysilane (PubChem CID 173133276) has the molecular formula C14H18O3Si2 and a molecular weight of 290.47 g/mol. Its IUPAC name is 2-hydroxy-1,2-diphenylethanone;silyloxysilane.
| Compound Name | 2-hydroxy-1,2-diphenylethanone;silyloxysilane |
|---|---|
| PubChem CID | 173133276 |
| Molecular Formula | C14H18O3Si2 |
| Molecular Weight | 290.47 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2-hydroxy-1,2-diphenylethanone;silyloxysilane |
| SMILES | O=C(c1ccccc1)C(O)c1ccccc1.[SiH3]O[SiH3] |
| InChI | InChI=1S/C14H12O2.H6OSi2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;2-1-3/h1-10,13,15H;2-3H3 |
| InChIKey | SHROPWKQDKQODY-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.47 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|