C35H32O5 — CID 87963505
benzaldehyde;1,2-diphenylethane-1,2-diol;2-hydroxy-1,2-diphenylethanone (PubChem CID 87963505) has the molecular formula C35H32O5 and a molecular weight of 532.64 g/mol. Its IUPAC name is benzaldehyde;1,2-diphenylethane-1,2-diol;2-hydroxy-1,2-diphenylethanone.
| Compound Name | benzaldehyde;1,2-diphenylethane-1,2-diol;2-hydroxy-1,2-diphenylethanone |
|---|---|
| PubChem CID | 87963505 |
| Molecular Formula | C35H32O5 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | benzaldehyde;1,2-diphenylethane-1,2-diol;2-hydroxy-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)C(O)c1ccccc1.O=Cc1ccccc1.OC(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H14O2.C14H12O2.C7H6O/c2*15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;8-6-7-4-2-1-3-5-7/h1-10,13-16H;1-10,13,15H;1-6H |
| InChIKey | LWHKNYXZUQNTTK-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|