C26H38O5S — CID 157232033
dodecane-1-sulfonic acid;2-hydroxy-1,2-diphenylethanone (PubChem CID 157232033) has the molecular formula C26H38O5S and a molecular weight of 462.65 g/mol. Its IUPAC name is dodecane-1-sulfonic acid;2-hydroxy-1,2-diphenylethanone.
| Compound Name | dodecane-1-sulfonic acid;2-hydroxy-1,2-diphenylethanone |
|---|---|
| PubChem CID | 157232033 |
| Molecular Formula | C26H38O5S |
| Molecular Weight | 462.65 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | dodecane-1-sulfonic acid;2-hydroxy-1,2-diphenylethanone |
| SMILES | CCCCCCCCCCCCS(=O)(=O)O.O=C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H12O2.C12H26O3S/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-2-3-4-5-6-7-8-9-10-11-12-16(13,14)15/h1-10,13,15H;2-12H2,1H3,(H,13,14,15) |
| InChIKey | AUFFZWXCIIZLOW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.65 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|