C26H30O2S — CID 70611989
2-hexylbenzenethiol;2-hydroxy-1,2-diphenylethanone (PubChem CID 70611989) has the molecular formula C26H30O2S and a molecular weight of 406.59 g/mol. Its IUPAC name is 2-hexylbenzenethiol;2-hydroxy-1,2-diphenylethanone.
| Compound Name | 2-hexylbenzenethiol;2-hydroxy-1,2-diphenylethanone |
|---|---|
| PubChem CID | 70611989 |
| Molecular Formula | C26H30O2S |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 2-hexylbenzenethiol;2-hydroxy-1,2-diphenylethanone |
| SMILES | CCCCCCc1ccccc1S.O=C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H12O2.C12H18S/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-2-3-4-5-8-11-9-6-7-10-12(11)13/h1-10,13,15H;6-7,9-10,13H,2-5,8H2,1H3 |
| InChIKey | VNJRHGRWPKJVEJ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|