About 2-butylbenzenethiol;trihydrofluoride
2-butylbenzenethiol;trihydrofluoride (PubChem CID 173024842) has the molecular formula C10H17F3S
and a molecular weight of 226.31 g/mol. Its IUPAC name is 2-butylbenzenethiol;trihydrofluoride.
Molecular Properties
| Compound Name | 2-butylbenzenethiol;trihydrofluoride |
| PubChem CID | 173024842 |
| Molecular Formula | C10H17F3S |
| Molecular Weight | 226.31 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-butylbenzenethiol;trihydrofluoride |
| SMILES | CCCCc1ccccc1S.F.F.F |
| InChI | InChI=1S/C10H14S.3FH/c1-2-3-6-9-7-4-5-8-10(9)11;;;/h4-5,7-8,11H,2-3,6H2,1H3;3*1H |
| InChIKey | AQMKGESDRUPUHL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-butylbenzenethiol;trihydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylbenzenethiol;trihydrofluoride?
The IUPAC name of 2-butylbenzenethiol;trihydrofluoride (CID 173024842) is 2-butylbenzenethiol;trihydrofluoride.
What is the SMILES notation for 2-butylbenzenethiol;trihydrofluoride?
The canonical SMILES for 2-butylbenzenethiol;trihydrofluoride is CCCCc1ccccc1S.F.F.F.
What is the InChIKey of 2-butylbenzenethiol;trihydrofluoride?
The InChIKey is AQMKGESDRUPUHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14S.3FH/c1-2-3-6-9-7-4-5-8-10(9)11;;;/h4-5,7-8,11H,2-3,6H2,1H3;3*1H.
What are the key properties of 2-butylbenzenethiol;trihydrofluoride?
2-butylbenzenethiol;trihydrofluoride has a molecular weight of 226.31 g/mol, XLogP of 3.78, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylbenzenethiol;trihydrofluoride is sourced from PubChem (CID 173024842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).