C14H22S2 — CID 140787148
4,5-dibutylbenzene-1,2-dithiol (PubChem CID 140787148) has the molecular formula C14H22S2 and a molecular weight of 254.46 g/mol. Its IUPAC name is 4,5-dibutylbenzene-1,2-dithiol.
| Compound Name | 4,5-dibutylbenzene-1,2-dithiol |
|---|---|
| PubChem CID | 140787148 |
| Molecular Formula | C14H22S2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 4,5-dibutylbenzene-1,2-dithiol |
| SMILES | CCCCc1cc(S)c(S)cc1CCCC |
| InChI | InChI=1S/C14H22S2/c1-3-5-7-11-9-13(15)14(16)10-12(11)8-6-4-2/h9-10,15-16H,3-8H2,1-2H3 |
| InChIKey | LVXOTRHNIZNNAJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|