About 4-butylthiophene-3-thiol
4-butylthiophene-3-thiol (PubChem CID 86122597) has the molecular formula C8H12S2
and a molecular weight of 172.32 g/mol. Its IUPAC name is 4-butylthiophene-3-thiol.
Molecular Properties
| Compound Name | 4-butylthiophene-3-thiol |
| PubChem CID | 86122597 |
| Molecular Formula | C8H12S2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 4-butylthiophene-3-thiol |
| SMILES | CCCCc1cscc1S |
| InChI | InChI=1S/C8H12S2/c1-2-3-4-7-5-10-6-8(7)9/h5-6,9H,2-4H2,1H3 |
| InChIKey | SFNVPDPHYLVASC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-butylthiophene-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butylthiophene-3-thiol?
The IUPAC name of 4-butylthiophene-3-thiol (CID 86122597) is 4-butylthiophene-3-thiol.
What is the SMILES notation for 4-butylthiophene-3-thiol?
The canonical SMILES for 4-butylthiophene-3-thiol is CCCCc1cscc1S.
What is the InChIKey of 4-butylthiophene-3-thiol?
The InChIKey is SFNVPDPHYLVASC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12S2/c1-2-3-4-7-5-10-6-8(7)9/h5-6,9H,2-4H2,1H3.
What are the key properties of 4-butylthiophene-3-thiol?
4-butylthiophene-3-thiol has a molecular weight of 172.32 g/mol, XLogP of 3.38, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butylthiophene-3-thiol is sourced from PubChem (CID 86122597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).