C14H22O2S2 — CID 177461948
4,5-dibutoxybenzene-1,2-dithiol (PubChem CID 177461948) has the molecular formula C14H22O2S2 and a molecular weight of 286.46 g/mol. Its IUPAC name is 4,5-dibutoxybenzene-1,2-dithiol.
| Compound Name | 4,5-dibutoxybenzene-1,2-dithiol |
|---|---|
| PubChem CID | 177461948 |
| Molecular Formula | C14H22O2S2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4,5-dibutoxybenzene-1,2-dithiol |
| SMILES | CCCCOc1cc(S)c(S)cc1OCCCC |
| InChI | InChI=1S/C14H22O2S2/c1-3-5-7-15-11-9-13(17)14(18)10-12(11)16-8-6-4-2/h9-10,17-18H,3-8H2,1-2H3 |
| InChIKey | WMWPSDGLZDIPFI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|