C44H40O4 — CID 71817287
12,13,26,27-tetrabutoxytricyclo[22.4.0.010,15]octacosa-1,2,3,4,5,6,7,8,9,11,13,15,16,17,18,19,20,21,22,23,25,27-docosaene (PubChem CID 71817287) has the molecular formula C44H40O4 and a molecular weight of 632.80 g/mol. Its IUPAC name is 12,13,26,27-tetrabutoxytricyclo[22.4.0.010,15]octacosa-1,2,3,4,5,6,7,8,9,11,13,15,16,17,18,19,20,21,22,23,25,27-docosaene.
| Compound Name | 12,13,26,27-tetrabutoxytricyclo[22.4.0.010,15]octacosa-1,2,3,4,5,6,7,8,9,11,13,15,16,17,18,19,20,21,22,23,25,27-docosaene |
|---|---|
| PubChem CID | 71817287 |
| Molecular Formula | C44H40O4 |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 632.29 |
| IUPAC Name | 12,13,26,27-tetrabutoxytricyclo[22.4.0.010,15]octacosa-1,2,3,4,5,6,7,8,9,11,13,15,16,17,18,19,20,21,22,23,25,27-docosaene |
| SMILES | CCCCOc1cc2c(cc1OCCCC)=C=C=C=C=C=C=C=C=c1cc(OCCCC)c(OCCCC)cc1=C=C=C=C=C=C=C=C=2 |
| InChI | InChI=1S/C44H40O4/c1-5-9-29-45-41-33-37-25-21-17-13-14-19-23-27-39-35-43(47-31-11-7-3)44(48-32-12-8-4)36-40(39)28-24-20-16-15-18-22-26-38(37)34-42(41)46-30-10-6-2/h33-36H,5-12,29-32H2,1-4H3 |
| InChIKey | QKVJZCJMBYUFJO-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|