C30H44O4S2 — CID 101023199
(E)-1,2-bis(3,4-dibutoxyphenyl)ethene-1,2-dithiol (PubChem CID 101023199) has the molecular formula C30H44O4S2 and a molecular weight of 532.81 g/mol. Its IUPAC name is (E)-1,2-bis(3,4-dibutoxyphenyl)ethene-1,2-dithiol.
| Compound Name | (E)-1,2-bis(3,4-dibutoxyphenyl)ethene-1,2-dithiol |
|---|---|
| PubChem CID | 101023199 |
| Molecular Formula | C30H44O4S2 |
| Molecular Weight | 532.81 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | (E)-1,2-bis(3,4-dibutoxyphenyl)ethene-1,2-dithiol |
| SMILES | CCCCOc1ccc(/C(S)=C(\S)c2ccc(OCCCC)c(OCCCC)c2)cc1OCCCC |
| InChI | InChI=1S/C30H44O4S2/c1-5-9-17-31-25-15-13-23(21-27(25)33-19-11-7-3)29(35)30(36)24-14-16-26(32-18-10-6-2)28(22-24)34-20-12-8-4/h13-16,21-22,35-36H,5-12,17-20H2,1-4H3/b30-29+ |
| InChIKey | HQAGUEXVHZCKRV-QVIHXGFCSA-N |
| XLogP | 9.09 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.81 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|