C14H21BrO2 — CID 10870333
4-bromo-1,2-dibutoxybenzene (PubChem CID 10870333) has the molecular formula C14H21BrO2 and a molecular weight of 301.22 g/mol. Its IUPAC name is 4-bromo-1,2-dibutoxybenzene.
| Compound Name | 4-bromo-1,2-dibutoxybenzene |
|---|---|
| PubChem CID | 10870333 |
| Molecular Formula | C14H21BrO2 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 4-bromo-1,2-dibutoxybenzene |
| SMILES | CCCCOc1ccc(Br)cc1OCCCC |
| InChI | InChI=1S/C14H21BrO2/c1-3-5-9-16-13-8-7-12(15)11-14(13)17-10-6-4-2/h7-8,11H,3-6,9-10H2,1-2H3 |
| InChIKey | KOOJRSSGMYRREA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|