About 2-heptylbenzene-1,4-dithiol
2-heptylbenzene-1,4-dithiol (PubChem CID 67231552) has the molecular formula C13H20S2
and a molecular weight of 240.44 g/mol. Its IUPAC name is 2-heptylbenzene-1,4-dithiol.
Molecular Properties
| Compound Name | 2-heptylbenzene-1,4-dithiol |
| PubChem CID | 67231552 |
| Molecular Formula | C13H20S2 |
| Molecular Weight | 240.44 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-heptylbenzene-1,4-dithiol |
| SMILES | CCCCCCCc1cc(S)ccc1S |
| InChI | InChI=1S/C13H20S2/c1-2-3-4-5-6-7-11-10-12(14)8-9-13(11)15/h8-10,14-15H,2-7H2,1H3 |
| InChIKey | GTXCRCBWGBBVGX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-heptylbenzene-1,4-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptylbenzene-1,4-dithiol?
The IUPAC name of 2-heptylbenzene-1,4-dithiol (CID 67231552) is 2-heptylbenzene-1,4-dithiol.
What is the SMILES notation for 2-heptylbenzene-1,4-dithiol?
The canonical SMILES for 2-heptylbenzene-1,4-dithiol is CCCCCCCc1cc(S)ccc1S.
What is the InChIKey of 2-heptylbenzene-1,4-dithiol?
The InChIKey is GTXCRCBWGBBVGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20S2/c1-2-3-4-5-6-7-11-10-12(14)8-9-13(11)15/h8-10,14-15H,2-7H2,1H3.
What are the key properties of 2-heptylbenzene-1,4-dithiol?
2-heptylbenzene-1,4-dithiol has a molecular weight of 240.44 g/mol, XLogP of 4.78, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptylbenzene-1,4-dithiol is sourced from PubChem (CID 67231552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).