C23H30O5 — CID 174584403
butyl prop-2-enoate;2-hydroxy-1,2-diphenylethanone;methoxymethane (PubChem CID 174584403) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is butyl prop-2-enoate;2-hydroxy-1,2-diphenylethanone;methoxymethane.
| Compound Name | butyl prop-2-enoate;2-hydroxy-1,2-diphenylethanone;methoxymethane |
|---|---|
| PubChem CID | 174584403 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | butyl prop-2-enoate;2-hydroxy-1,2-diphenylethanone;methoxymethane |
| SMILES | C=CC(=O)OCCCC.COC.O=C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H12O2.C7H12O2.C2H6O/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;1-3-5-6-9-7(8)4-2;1-3-2/h1-10,13,15H;4H,2-3,5-6H2,1H3;1-2H3 |
| InChIKey | SZAMCTIKMMXFIZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|