C23H26F2O2 — CID 122130554
butyl prop-2-enoate;2-ethenyl-1,4-difluorobenzene;styrene (PubChem CID 122130554) has the molecular formula C23H26F2O2 and a molecular weight of 372.46 g/mol. Its IUPAC name is butyl prop-2-enoate;2-ethenyl-1,4-difluorobenzene;styrene.
| Compound Name | butyl prop-2-enoate;2-ethenyl-1,4-difluorobenzene;styrene |
|---|---|
| PubChem CID | 122130554 |
| Molecular Formula | C23H26F2O2 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | butyl prop-2-enoate;2-ethenyl-1,4-difluorobenzene;styrene |
| SMILES | C=CC(=O)OCCCC.C=Cc1cc(F)ccc1F.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H6F2.C8H8.C7H12O2/c1-2-6-5-7(9)3-4-8(6)10;1-2-8-6-4-3-5-7-8;1-3-5-6-9-7(8)4-2/h2-5H,1H2;2-7H,1H2;4H,2-3,5-6H2,1H3 |
| InChIKey | CVFVSQQCAJUJGQ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|