C27H28O3 — CID 175464562
cyclohexyl(phenyl)methanone;2-hydroxy-1,2-diphenylethanone (PubChem CID 175464562) has the molecular formula C27H28O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is cyclohexyl(phenyl)methanone;2-hydroxy-1,2-diphenylethanone.
| Compound Name | cyclohexyl(phenyl)methanone;2-hydroxy-1,2-diphenylethanone |
|---|---|
| PubChem CID | 175464562 |
| Molecular Formula | C27H28O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | cyclohexyl(phenyl)methanone;2-hydroxy-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)C(O)c1ccccc1.O=C(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C14H12O2.C13H16O/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13,15H;1,3-4,7-8,12H,2,5-6,9-10H2 |
| InChIKey | VDGUJZMHTSTLGZ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |