C27H28O4 — CID 155168101
(1-hydroxycyclohexyl)-phenylmethanone;2-hydroxy-1,2-diphenylethanone (PubChem CID 155168101) has the molecular formula C27H28O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is (1-hydroxycyclohexyl)-phenylmethanone;2-hydroxy-1,2-diphenylethanone.
| Compound Name | (1-hydroxycyclohexyl)-phenylmethanone;2-hydroxy-1,2-diphenylethanone |
|---|---|
| PubChem CID | 155168101 |
| Molecular Formula | C27H28O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (1-hydroxycyclohexyl)-phenylmethanone;2-hydroxy-1,2-diphenylethanone |
| SMILES | O=C(c1ccccc1)C(O)c1ccccc1.O=C(c1ccccc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C14H12O2.C13H16O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;14-12(11-7-3-1-4-8-11)13(15)9-5-2-6-10-13/h1-10,13,15H;1,3-4,7-8,15H,2,5-6,9-10H2 |
| InChIKey | ALZXVHHHWWJCPV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |