C13H20N2O2 — CID 161340998
hydrazine;(1-hydroxycyclohexyl)-phenylmethanone (PubChem CID 161340998) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is hydrazine;(1-hydroxycyclohexyl)-phenylmethanone.
| Compound Name | hydrazine;(1-hydroxycyclohexyl)-phenylmethanone |
|---|---|
| PubChem CID | 161340998 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | hydrazine;(1-hydroxycyclohexyl)-phenylmethanone |
| SMILES | NN.O=C(c1ccccc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C13H16O2.H4N2/c14-12(11-7-3-1-4-8-11)13(15)9-5-2-6-10-13;1-2/h1,3-4,7-8,15H,2,5-6,9-10H2;1-2H2 |
| InChIKey | VMQVIEKDCWLZQR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|