C28H36O8 — CID 162007679
2,2-bis(prop-2-enoyloxymethyl)butyl prop-2-enoate;(1-hydroxycyclohexyl)-phenylmethanone (PubChem CID 162007679) has the molecular formula C28H36O8 and a molecular weight of 500.59 g/mol. Its IUPAC name is 2,2-bis(prop-2-enoyloxymethyl)butyl prop-2-enoate;(1-hydroxycyclohexyl)-phenylmethanone.
| Compound Name | 2,2-bis(prop-2-enoyloxymethyl)butyl prop-2-enoate;(1-hydroxycyclohexyl)-phenylmethanone |
|---|---|
| PubChem CID | 162007679 |
| Molecular Formula | C28H36O8 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 2,2-bis(prop-2-enoyloxymethyl)butyl prop-2-enoate;(1-hydroxycyclohexyl)-phenylmethanone |
| SMILES | C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)C=C.O=C(c1ccccc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C15H20O6.C13H16O2/c1-5-12(16)19-9-15(8-4,10-20-13(17)6-2)11-21-14(18)7-3;14-12(11-7-3-1-4-8-11)13(15)9-5-2-6-10-13/h5-7H,1-3,8-11H2,4H3;1,3-4,7-8,15H,2,5-6,9-10H2 |
| InChIKey | YTBAZDCQADSMKH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|