C32H44O12 — CID 170682343
bis[2,2-bis(prop-2-enoyloxymethyl)butyl] cyclohexane-1,4-dicarboxylate (PubChem CID 170682343) has the molecular formula C32H44O12 and a molecular weight of 620.69 g/mol. Its IUPAC name is bis[2,2-bis(prop-2-enoyloxymethyl)butyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | bis[2,2-bis(prop-2-enoyloxymethyl)butyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 170682343 |
| Molecular Formula | C32H44O12 |
| Molecular Weight | 620.69 g/mol |
| Exact Mass | 620.28 |
| IUPAC Name | bis[2,2-bis(prop-2-enoyloxymethyl)butyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)C1CCC(C(=O)OCC(CC)(COC(=O)C=C)COC(=O)C=C)CC1 |
| InChI | InChI=1S/C32H44O12/c1-7-25(33)39-17-31(11-5,18-40-26(34)8-2)21-43-29(37)23-13-15-24(16-14-23)30(38)44-22-32(12-6,19-41-27(35)9-3)20-42-28(36)10-4/h7-10,23-24H,1-4,11-22H2,5-6H3 |
| InChIKey | VFZCHUZXHHCREC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.69 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|