C22H36O6 — CID 20870650
[2-(acetyloxymethyl)-2-(cyclohexanecarbonyloxymethyl)butyl] cyclohexanecarboxylate (PubChem CID 20870650) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is [2-(acetyloxymethyl)-2-(cyclohexanecarbonyloxymethyl)butyl] cyclohexanecarboxylate.
| Compound Name | [2-(acetyloxymethyl)-2-(cyclohexanecarbonyloxymethyl)butyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 20870650 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | [2-(acetyloxymethyl)-2-(cyclohexanecarbonyloxymethyl)butyl] cyclohexanecarboxylate |
| SMILES | CCC(COC(C)=O)(COC(=O)C1CCCCC1)COC(=O)C1CCCCC1 |
| InChI | InChI=1S/C22H36O6/c1-3-22(14-26-17(2)23,15-27-20(24)18-10-6-4-7-11-18)16-28-21(25)19-12-8-5-9-13-19/h18-19H,3-16H2,1-2H3 |
| InChIKey | SSNVRECWRRFOOZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|