C27H44O6 — CID 15607732
2,2-bis(cyclohexanecarbonyloxymethyl)butyl cyclohexanecarboxylate (PubChem CID 15607732) has the molecular formula C27H44O6 and a molecular weight of 464.64 g/mol. Its IUPAC name is 2,2-bis(cyclohexanecarbonyloxymethyl)butyl cyclohexanecarboxylate.
| Compound Name | 2,2-bis(cyclohexanecarbonyloxymethyl)butyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 15607732 |
| Molecular Formula | C27H44O6 |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.31 |
| IUPAC Name | 2,2-bis(cyclohexanecarbonyloxymethyl)butyl cyclohexanecarboxylate |
| SMILES | CCC(COC(=O)C1CCCCC1)(COC(=O)C1CCCCC1)COC(=O)C1CCCCC1 |
| InChI | InChI=1S/C27H44O6/c1-2-27(18-31-24(28)21-12-6-3-7-13-21,19-32-25(29)22-14-8-4-9-15-22)20-33-26(30)23-16-10-5-11-17-23/h21-23H,2-20H2,1H3 |
| InChIKey | HUTFTTCPAJRAGQ-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|