C30H40O12 — CID 170682315
bis[2,2-bis(prop-2-enoyloxymethyl)butyl] (E)-hex-3-enedioate (PubChem CID 170682315) has the molecular formula C30H40O12 and a molecular weight of 592.64 g/mol. Its IUPAC name is bis[2,2-bis(prop-2-enoyloxymethyl)butyl] (E)-hex-3-enedioate.
| Compound Name | bis[2,2-bis(prop-2-enoyloxymethyl)butyl] (E)-hex-3-enedioate |
|---|---|
| PubChem CID | 170682315 |
| Molecular Formula | C30H40O12 |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | bis[2,2-bis(prop-2-enoyloxymethyl)butyl] (E)-hex-3-enedioate |
| SMILES | C=CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)C/C=C/CC(=O)OCC(CC)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C30H40O12/c1-7-23(31)37-17-29(11-5,18-38-24(32)8-2)21-41-27(35)15-13-14-16-28(36)42-22-30(12-6,19-39-25(33)9-3)20-40-26(34)10-4/h7-10,13-14H,1-4,11-12,15-22H2,5-6H3/b14-13+ |
| InChIKey | KPYZBUIBEQCBCF-BUHFOSPRSA-N |
| XLogP | 3.12 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|